C28H49NO3 — CID 68615071
2-[2-(dihexylamino)ethoxy]ethyl 2-ethyl-2-phenylbutanoate (PubChem CID 68615071) has the molecular formula C28H49NO3 and a molecular weight of 447.70 g/mol. Its IUPAC name is 2-[2-(dihexylamino)ethoxy]ethyl 2-ethyl-2-phenylbutanoate.
| Compound Name | 2-[2-(dihexylamino)ethoxy]ethyl 2-ethyl-2-phenylbutanoate |
|---|---|
| PubChem CID | 68615071 |
| Molecular Formula | C28H49NO3 |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 447.37 |
| IUPAC Name | 2-[2-(dihexylamino)ethoxy]ethyl 2-ethyl-2-phenylbutanoate |
| SMILES | CCCCCCN(CCCCCC)CCOCCOC(=O)C(CC)(CC)c1ccccc1 |
| InChI | InChI=1S/C28H49NO3/c1-5-9-11-16-20-29(21-17-12-10-6-2)22-23-31-24-25-32-27(30)28(7-3,8-4)26-18-14-13-15-19-26/h13-15,18-19H,5-12,16-17,20-25H2,1-4H3 |
| InChIKey | NIHVOVHXUFAQCV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|