C23H31NO3 — CID 17997
2-[butyl(ethyl)amino]ethyl 2-methoxy-2,2-diphenylacetate (PubChem CID 17997) has the molecular formula C23H31NO3 and a molecular weight of 369.50 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]ethyl 2-methoxy-2,2-diphenylacetate.
| Compound Name | 2-[butyl(ethyl)amino]ethyl 2-methoxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 17997 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[butyl(ethyl)amino]ethyl 2-methoxy-2,2-diphenylacetate |
| SMILES | CCCCN(CC)CCOC(=O)C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO3/c1-4-6-17-24(5-2)18-19-27-22(25)23(26-3,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16H,4-6,17-19H2,1-3H3 |
| InChIKey | XQBRAXUXQQMJFW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |