C15H33NO2 — CID 157124650
methane;2-piperidin-1-ylethyl 2,2-dimethylbutanoate (PubChem CID 157124650) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is methane;2-piperidin-1-ylethyl 2,2-dimethylbutanoate.
| Compound Name | methane;2-piperidin-1-ylethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 157124650 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | methane;2-piperidin-1-ylethyl 2,2-dimethylbutanoate |
| SMILES | C.C.CCC(C)(C)C(=O)OCCN1CCCCC1 |
| InChI | InChI=1S/C13H25NO2.2CH4/c1-4-13(2,3)12(15)16-11-10-14-8-6-5-7-9-14;;/h4-11H2,1-3H3;2*1H4 |
| InChIKey | AIJGRAKIYGOZHR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |