About 2-piperidin-1-ylethyl 2-chloroacetate
2-piperidin-1-ylethyl 2-chloroacetate (PubChem CID 12849131) has the molecular formula C9H16ClNO2
and a molecular weight of 205.68 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2-chloroacetate |
| PubChem CID | 12849131 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-chloroacetate |
| SMILES | O=C(CCl)OCCN1CCCCC1 |
| InChI | InChI=1S/C9H16ClNO2/c10-8-9(12)13-7-6-11-4-2-1-3-5-11/h1-8H2 |
| InChIKey | QMQJVULFVMEASB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2-chloroacetate?
The IUPAC name of 2-piperidin-1-ylethyl 2-chloroacetate (CID 12849131) is 2-piperidin-1-ylethyl 2-chloroacetate.
What is the SMILES notation for 2-piperidin-1-ylethyl 2-chloroacetate?
The canonical SMILES for 2-piperidin-1-ylethyl 2-chloroacetate is O=C(CCl)OCCN1CCCCC1.
What is the InChIKey of 2-piperidin-1-ylethyl 2-chloroacetate?
The InChIKey is QMQJVULFVMEASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO2/c10-8-9(12)13-7-6-11-4-2-1-3-5-11/h1-8H2.
What are the key properties of 2-piperidin-1-ylethyl 2-chloroacetate?
2-piperidin-1-ylethyl 2-chloroacetate has a molecular weight of 205.68 g/mol, XLogP of 1.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2-chloroacetate is sourced from PubChem (CID 12849131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).