About 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate
2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate (PubChem CID 89180853) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate |
| PubChem CID | 89180853 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate |
| SMILES | Nc1ccc(CC(=O)OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C14H20N2O2/c15-13-5-3-12(4-6-13)11-14(17)18-10-9-16-7-1-2-8-16/h3-6H,1-2,7-11,15H2 |
| InChIKey | RWZBSBWNYZVRIL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate?
The IUPAC name of 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate (CID 89180853) is 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate?
The canonical SMILES for 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate is Nc1ccc(CC(=O)OCCN2CCCC2)cc1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate?
The InChIKey is RWZBSBWNYZVRIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c15-13-5-3-12(4-6-13)11-14(17)18-10-9-16-7-1-2-8-16/h3-6H,1-2,7-11,15H2.
What are the key properties of 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate?
2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate has a molecular weight of 248.33 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl 2-(4-aminophenyl)acetate is sourced from PubChem (CID 89180853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).