About 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate (PubChem CID 104563048) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate |
| PubChem CID | 104563048 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate |
| SMILES | COCCOCCOCCOC(=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C15H23NO5/c1-18-6-7-19-8-9-20-10-11-21-15(17)12-13-2-4-14(16)5-3-13/h2-5H,6-12,16H2,1H3 |
| InChIKey | XJVAEKCEYDHKLY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate (CID 104563048) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate is COCCOCCOCCOC(=O)Cc1ccc(N)cc1.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate?
The InChIKey is XJVAEKCEYDHKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO5/c1-18-6-7-19-8-9-20-10-11-21-15(17)12-13-2-4-14(16)5-3-13/h2-5H,6-12,16H2,1H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate?
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate has a molecular weight of 297.35 g/mol, XLogP of 1.03, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-(4-aminophenyl)acetate is sourced from PubChem (CID 104563048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).