C45H56N4O12 — CID 59273590
2-[3-[2-[2-(4-aminophenyl)acetyl]oxyethoxy]-2,2-bis[2-[2-(4-aminophenyl)acetyl]oxyethoxymethyl]propoxy]ethyl 2-(4-aminophenyl)acetate (PubChem CID 59273590) has the molecular formula C45H56N4O12 and a molecular weight of 844.96 g/mol. Its IUPAC name is 2-[3-[2-[2-(4-aminophenyl)acetyl]oxyethoxy]-2,2-bis[2-[2-(4-aminophenyl)acetyl]oxyethoxymethyl]propoxy]ethyl 2-(4-aminophenyl)acetate.
| Compound Name | 2-[3-[2-[2-(4-aminophenyl)acetyl]oxyethoxy]-2,2-bis[2-[2-(4-aminophenyl)acetyl]oxyethoxymethyl]propoxy]ethyl 2-(4-aminophenyl)acetate |
|---|---|
| PubChem CID | 59273590 |
| Molecular Formula | C45H56N4O12 |
| Molecular Weight | 844.96 g/mol |
| Exact Mass | 844.39 |
| IUPAC Name | 2-[3-[2-[2-(4-aminophenyl)acetyl]oxyethoxy]-2,2-bis[2-[2-(4-aminophenyl)acetyl]oxyethoxymethyl]propoxy]ethyl 2-(4-aminophenyl)acetate |
| SMILES | Nc1ccc(CC(=O)OCCOCC(COCCOC(=O)Cc2ccc(N)cc2)(COCCOC(=O)Cc2ccc(N)cc2)COCCOC(=O)Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C45H56N4O12/c46-37-9-1-33(2-10-37)25-41(50)58-21-17-54-29-45(30-55-18-22-59-42(51)26-34-3-11-38(47)12-4-34,31-56-19-23-60-43(52)27-35-5-13-39(48)14-6-35)32-57-20-24-61-44(53)28-36-7-15-40(49)16-8-36/h1-16H,17-32,46-49H2 |
| InChIKey | POUBUJNZEANBIU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 246.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.96 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|