C13H19NO4 — CID 61316404
2-(2-hydroxyethoxy)ethyl 3-(4-aminophenyl)propanoate (PubChem CID 61316404) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 3-(4-aminophenyl)propanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 3-(4-aminophenyl)propanoate |
|---|---|
| PubChem CID | 61316404 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 3-(4-aminophenyl)propanoate |
| SMILES | Nc1ccc(CCC(=O)OCCOCCO)cc1 |
| InChI | InChI=1S/C13H19NO4/c14-12-4-1-11(2-5-12)3-6-13(16)18-10-9-17-8-7-15/h1-2,4-5,15H,3,6-10,14H2 |
| InChIKey | CNGBSSVUEIYSEJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|