C21H34Cl2N2O3 — CID 134119198
3-(4-methylpiperazin-1-yl)propyl 2-(1-hydroxycyclopentyl)-2-phenylacetate;dihydrochloride (PubChem CID 134119198) has the molecular formula C21H34Cl2N2O3 and a molecular weight of 433.42 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl 2-(1-hydroxycyclopentyl)-2-phenylacetate;dihydrochloride.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl 2-(1-hydroxycyclopentyl)-2-phenylacetate;dihydrochloride |
|---|---|
| PubChem CID | 134119198 |
| Molecular Formula | C21H34Cl2N2O3 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl 2-(1-hydroxycyclopentyl)-2-phenylacetate;dihydrochloride |
| SMILES | CN1CCN(CCCOC(=O)C(c2ccccc2)C2(O)CCCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C21H32N2O3.2ClH/c1-22-13-15-23(16-14-22)12-7-17-26-20(24)19(18-8-3-2-4-9-18)21(25)10-5-6-11-21;;/h2-4,8-9,19,25H,5-7,10-17H2,1H3;2*1H |
| InChIKey | YXAKCNHZPDONPN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|