C25H30ClNO4 — CID 57297693
ethyl 2-(4-chlorophenyl)-2-[4-hydroxy-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]acetate (PubChem CID 57297693) has the molecular formula C25H30ClNO4 and a molecular weight of 443.97 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-2-[4-hydroxy-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]acetate.
| Compound Name | ethyl 2-(4-chlorophenyl)-2-[4-hydroxy-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 57297693 |
| Molecular Formula | C25H30ClNO4 |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-2-[4-hydroxy-1-(4-oxo-4-phenylbutyl)piperidin-4-yl]acetate |
| SMILES | CCOC(=O)C(c1ccc(Cl)cc1)C1(O)CCN(CCCC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30ClNO4/c1-2-31-24(29)23(20-10-12-21(26)13-11-20)25(30)14-17-27(18-15-25)16-6-9-22(28)19-7-4-3-5-8-19/h3-5,7-8,10-13,23,30H,2,6,9,14-18H2,1H3 |
| InChIKey | QNHWLSFRYMFGKC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |