C24H30ClNO3 — CID 57023331
ethyl 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-2-(4-methylphenyl)acetate (PubChem CID 57023331) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is ethyl 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-2-(4-methylphenyl)acetate.
| Compound Name | ethyl 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 57023331 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | ethyl 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-2-(4-methylphenyl)acetate |
| SMILES | CCOC(=O)C(c1ccc(C)cc1)C1(O)CCN(CC(Cl)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30ClNO3/c1-3-29-23(27)22(20-11-9-18(2)10-12-20)24(28)13-15-26(16-14-24)17-21(25)19-7-5-4-6-8-19/h4-12,21-22,28H,3,13-17H2,1-2H3 |
| InChIKey | BLCXZGMYTBGLQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|