C20H31ClN2O2 — CID 57182073
2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]heptanamide (PubChem CID 57182073) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]heptanamide.
| Compound Name | 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]heptanamide |
|---|---|
| PubChem CID | 57182073 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]heptanamide |
| SMILES | CCCCCC(C(N)=O)C1(O)CCN(CC(Cl)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H31ClN2O2/c1-2-3-5-10-17(19(22)24)20(25)11-13-23(14-12-20)15-18(21)16-8-6-4-7-9-16/h4,6-9,17-18,25H,2-3,5,10-15H2,1H3,(H2,22,24) |
| InChIKey | KPKYDSIUMUPZKJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|