C20H31ClN2O2 — CID 57303868
2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-N-propan-2-ylbutanamide (PubChem CID 57303868) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-N-propan-2-ylbutanamide.
| Compound Name | 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 57303868 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-[1-(2-chloro-2-phenylethyl)-4-hydroxypiperidin-4-yl]-N-propan-2-ylbutanamide |
| SMILES | CCC(C(=O)NC(C)C)C1(O)CCN(CC(Cl)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H31ClN2O2/c1-4-17(19(24)22-15(2)3)20(25)10-12-23(13-11-20)14-18(21)16-8-6-5-7-9-16/h5-9,15,17-18,25H,4,10-14H2,1-3H3,(H,22,24) |
| InChIKey | KBODJVPSHXMKPY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|