C23H35FN2O2 — CID 57164548
N-cyclohexyl-2-[1-(2-fluoro-2-phenylethyl)-4-hydroxypiperidin-4-yl]butanamide (PubChem CID 57164548) has the molecular formula C23H35FN2O2 and a molecular weight of 390.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[1-(2-fluoro-2-phenylethyl)-4-hydroxypiperidin-4-yl]butanamide.
| Compound Name | N-cyclohexyl-2-[1-(2-fluoro-2-phenylethyl)-4-hydroxypiperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 57164548 |
| Molecular Formula | C23H35FN2O2 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | N-cyclohexyl-2-[1-(2-fluoro-2-phenylethyl)-4-hydroxypiperidin-4-yl]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)C1(O)CCN(CC(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H35FN2O2/c1-2-20(22(27)25-19-11-7-4-8-12-19)23(28)13-15-26(16-14-23)17-21(24)18-9-5-3-6-10-18/h3,5-6,9-10,19-21,28H,2,4,7-8,11-17H2,1H3,(H,25,27) |
| InChIKey | YOQIHLKWYOTAEJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |