C17H24F2N2OS — CID 95621085
(2S)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-phenylsulfanylbutanamide (PubChem CID 95621085) has the molecular formula C17H24F2N2OS and a molecular weight of 342.45 g/mol. Its IUPAC name is (2S)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-phenylsulfanylbutanamide.
| Compound Name | (2S)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 95621085 |
| Molecular Formula | C17H24F2N2OS |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2S)-N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-phenylsulfanylbutanamide |
| SMILES | CC[C@H](Sc1ccccc1)C(=O)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C17H24F2N2OS/c1-2-15(23-14-6-4-3-5-7-14)17(22)20-13-8-10-21(11-9-13)12-16(18)19/h3-7,13,15-16H,2,8-12H2,1H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | ZKQQVSYKWFLSBI-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |