C15H22N2O2S — CID 120947547
N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-phenylsulfanylbutanamide (PubChem CID 120947547) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-phenylsulfanylbutanamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 120947547 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-phenylsulfanylbutanamide |
| SMILES | CCC(Sc1ccccc1)C(=O)NCC1CNCC1O |
| InChI | InChI=1S/C15H22N2O2S/c1-2-14(20-12-6-4-3-5-7-12)15(19)17-9-11-8-16-10-13(11)18/h3-7,11,13-14,16,18H,2,8-10H2,1H3,(H,17,19) |
| InChIKey | MMERXQBWTUFKCX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |