C17H25ClN2OS — CID 119457312
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-phenylsulfanylbutanamide;hydrochloride (PubChem CID 119457312) has the molecular formula C17H25ClN2OS and a molecular weight of 340.92 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-phenylsulfanylbutanamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-phenylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119457312 |
| Molecular Formula | C17H25ClN2OS |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-phenylsulfanylbutanamide;hydrochloride |
| SMILES | CCC(Sc1ccccc1)C(=O)NC1CC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C17H24N2OS.ClH/c1-2-16(21-15-6-4-3-5-7-15)17(20)19-14-10-12-8-9-13(11-14)18-12;/h3-7,12-14,16,18H,2,8-11H2,1H3,(H,19,20);1H |
| InChIKey | DNRYKFBFXUQXAS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |