C16H20FNO3S — CID 141014181
1-[2-(4-fluorophenyl)sulfanylbutanoyl]piperidine-4-carboxylic acid (PubChem CID 141014181) has the molecular formula C16H20FNO3S and a molecular weight of 325.40 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)sulfanylbutanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(4-fluorophenyl)sulfanylbutanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 141014181 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[2-(4-fluorophenyl)sulfanylbutanoyl]piperidine-4-carboxylic acid |
| SMILES | CCC(Sc1ccc(F)cc1)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H20FNO3S/c1-2-14(22-13-5-3-12(17)4-6-13)15(19)18-9-7-11(8-10-18)16(20)21/h3-6,11,14H,2,7-10H2,1H3,(H,20,21) |
| InChIKey | PEOFKNKOECBCFK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |