C14H18O4 — CID 86338343
ethyl (2R)-2-(2-methyl-1,3-dioxolan-2-yl)-2-phenylacetate (PubChem CID 86338343) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (2R)-2-(2-methyl-1,3-dioxolan-2-yl)-2-phenylacetate.
| Compound Name | ethyl (2R)-2-(2-methyl-1,3-dioxolan-2-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 86338343 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (2R)-2-(2-methyl-1,3-dioxolan-2-yl)-2-phenylacetate |
| SMILES | CCOC(=O)[C@H](c1ccccc1)C1(C)OCCO1 |
| InChI | InChI=1S/C14H18O4/c1-3-16-13(15)12(11-7-5-4-6-8-11)14(2)17-9-10-18-14/h4-8,12H,3,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | GEESQPQCIYFSEE-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |