C23H22O3 — CID 10020523
ethyl 2-[(1S,5R)-7-oxo-6-phenyl-6-bicyclo[3.2.0]hept-3-enyl]-2-phenylacetate (PubChem CID 10020523) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 2-[(1S,5R)-7-oxo-6-phenyl-6-bicyclo[3.2.0]hept-3-enyl]-2-phenylacetate.
| Compound Name | ethyl 2-[(1S,5R)-7-oxo-6-phenyl-6-bicyclo[3.2.0]hept-3-enyl]-2-phenylacetate |
|---|---|
| PubChem CID | 10020523 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl 2-[(1S,5R)-7-oxo-6-phenyl-6-bicyclo[3.2.0]hept-3-enyl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)C1(c2ccccc2)C(=O)[C@H]2CC=C[C@H]21 |
| InChI | InChI=1S/C23H22O3/c1-2-26-22(25)20(16-10-5-3-6-11-16)23(17-12-7-4-8-13-17)19-15-9-14-18(19)21(23)24/h3-13,15,18-20H,2,14H2,1H3/t18-,19+,20?,23?/m0/s1 |
| InChIKey | QJASSXNZGURRDL-HJLOMXBNSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|