C23H28N2O3S — CID 25002905
3-[3-(cyclopropylmethyl)-2-methyl-2H-imidazol-1-yl]propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate (PubChem CID 25002905) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-[3-(cyclopropylmethyl)-2-methyl-2H-imidazol-1-yl]propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate.
| Compound Name | 3-[3-(cyclopropylmethyl)-2-methyl-2H-imidazol-1-yl]propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 25002905 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 3-[3-(cyclopropylmethyl)-2-methyl-2H-imidazol-1-yl]propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate |
| SMILES | CC1N(CCCOC(=O)C(O)(c2ccccc2)c2cccs2)C=CN1CC1CC1 |
| InChI | InChI=1S/C23H28N2O3S/c1-18-24(13-14-25(18)17-19-10-11-19)12-6-15-28-22(26)23(27,21-9-5-16-29-21)20-7-3-2-4-8-20/h2-5,7-9,13-14,16,18-19,27H,6,10-12,15,17H2,1H3 |
| InChIKey | OFXACAIPUKWRLM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|