C25H27N2O3S2+ — CID 87436589
3-[2-methyl-3-(2-phenylethyl)imidazol-1-ium-1-yl]propyl 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 87436589) has the molecular formula C25H27N2O3S2+ and a molecular weight of 467.64 g/mol. Its IUPAC name is 3-[2-methyl-3-(2-phenylethyl)imidazol-1-ium-1-yl]propyl 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | 3-[2-methyl-3-(2-phenylethyl)imidazol-1-ium-1-yl]propyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 87436589 |
| Molecular Formula | C25H27N2O3S2+ |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3-[2-methyl-3-(2-phenylethyl)imidazol-1-ium-1-yl]propyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | Cc1n(CCc2ccccc2)cc[n+]1CCCOC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C25H27N2O3S2/c1-20-26(15-16-27(20)14-12-21-8-3-2-4-9-21)13-7-17-30-24(28)25(29,22-10-5-18-31-22)23-11-6-19-32-23/h2-6,8-11,15-16,18-19,29H,7,12-14,17H2,1H3/q+1 |
| InChIKey | XTSOUCQQENFZKC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|