C29H31N2O3+ — CID 57452772
2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl 2-hydroxy-2,2-bis(3-methylphenyl)acetate (PubChem CID 57452772) has the molecular formula C29H31N2O3+ and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl 2-hydroxy-2,2-bis(3-methylphenyl)acetate.
| Compound Name | 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl 2-hydroxy-2,2-bis(3-methylphenyl)acetate |
|---|---|
| PubChem CID | 57452772 |
| Molecular Formula | C29H31N2O3+ |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl 2-hydroxy-2,2-bis(3-methylphenyl)acetate |
| SMILES | Cc1cccc(C(O)(C(=O)OCCn2cc[n+](Cc3ccccc3)c2C)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C29H31N2O3/c1-22-9-7-13-26(19-22)29(33,27-14-8-10-23(2)20-27)28(32)34-18-17-30-15-16-31(24(30)3)21-25-11-5-4-6-12-25/h4-16,19-20,33H,17-18,21H2,1-3H3/q+1 |
| InChIKey | FMIUYBHNKXCNPG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|