C15H18BrF3N2 — CID 158626766
2-methyl-1-propyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-3-ium bromide (PubChem CID 158626766) has the molecular formula C15H18BrF3N2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 2-methyl-1-propyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-3-ium bromide.
| Compound Name | 2-methyl-1-propyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-3-ium bromide |
|---|---|
| PubChem CID | 158626766 |
| Molecular Formula | C15H18BrF3N2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-methyl-1-propyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-3-ium bromide |
| SMILES | CCCn1cc[n+](Cc2cccc(C(F)(F)F)c2)c1C.[Br-] |
| InChI | InChI=1S/C15H18F3N2.BrH/c1-3-7-19-8-9-20(12(19)2)11-13-5-4-6-14(10-13)15(16,17)18;/h4-6,8-10H,3,7,11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | AGSZWDFQXYJPJE-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|