C10H13F3N+ — CID 40609421
ethyl-[[3-(trifluoromethyl)phenyl]methyl]azanium (PubChem CID 40609421) has the molecular formula C10H13F3N+ and a molecular weight of 204.22 g/mol. Its IUPAC name is ethyl-[[3-(trifluoromethyl)phenyl]methyl]azanium.
| Compound Name | ethyl-[[3-(trifluoromethyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 40609421 |
| Molecular Formula | C10H13F3N+ |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | ethyl-[[3-(trifluoromethyl)phenyl]methyl]azanium |
| SMILES | CC[NH2+]Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N/c1-2-14-7-8-4-3-5-9(6-8)10(11,12)13/h3-6,14H,2,7H2,1H3/p+1 |
| InChIKey | MGSDOCJVFWZVGG-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |