C24H25F2N2O3+ — CID 25007921
2-[3-(cyclopropylmethyl)-2-methylimidazol-3-ium-1-yl]ethyl 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 25007921) has the molecular formula C24H25F2N2O3+ and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[3-(cyclopropylmethyl)-2-methylimidazol-3-ium-1-yl]ethyl 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | 2-[3-(cyclopropylmethyl)-2-methylimidazol-3-ium-1-yl]ethyl 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 25007921 |
| Molecular Formula | C24H25F2N2O3+ |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[3-(cyclopropylmethyl)-2-methylimidazol-3-ium-1-yl]ethyl 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
| SMILES | Cc1n(CCOC(=O)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)cc[n+]1CC1CC1 |
| InChI | InChI=1S/C24H25F2N2O3/c1-17-27(12-13-28(17)16-18-2-3-18)14-15-31-23(29)24(30,19-4-8-21(25)9-5-19)20-6-10-22(26)11-7-20/h4-13,18,30H,2-3,14-16H2,1H3/q+1 |
| InChIKey | WCMXMZZEKGZIRH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|