(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate

C18H16F2O3 — CID 150729585

IUPAC(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate
SMILESCC1(OC(=O)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1
InChIInChI=1S/C18H16F2O3/c1-17(10-11-17)23-16(21)18(22,12-2-6-14(19)7-3-12)13-4-8-15(20)9-5-13/h2-9,22H,10-11H2,1H3
InChIKeyJROGWYSMIFAMOC-UHFFFAOYSA-N
MW318.32 g/mol
LogP3.30
Rot. Bonds4

About (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate

(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 150729585) has the molecular formula C18H16F2O3 and a molecular weight of 318.32 g/mol. Its IUPAC name is (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.

Molecular Properties

Compound Name(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate
PubChem CID150729585
Molecular FormulaC18H16F2O3
Molecular Weight318.32 g/mol
Exact Mass318.11
IUPAC Name(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate
SMILESCC1(OC(=O)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1
InChIInChI=1S/C18H16F2O3/c1-17(10-11-17)23-16(21)18(22,12-2-6-14(19)7-3-12)13-4-8-15(20)9-5-13/h2-9,22H,10-11H2,1H3
InChIKeyJROGWYSMIFAMOC-UHFFFAOYSA-N
XLogP3.30
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.32
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate?
The IUPAC name of (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (CID 150729585) is (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.
What is the SMILES notation for (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate?
The canonical SMILES for (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate is CC1(OC(=O)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate?
The InChIKey is JROGWYSMIFAMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2O3/c1-17(10-11-17)23-16(21)18(22,12-2-6-14(19)7-3-12)13-4-8-15(20)9-5-13/h2-9,22H,10-11H2,1H3.
What are the key properties of (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate?
(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate has a molecular weight of 318.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate is sourced from PubChem (CID 150729585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).