C18H16F2O3 — CID 150729585
(1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 150729585) has the molecular formula C18H16F2O3 and a molecular weight of 318.32 g/mol. Its IUPAC name is (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 150729585 |
| Molecular Formula | C18H16F2O3 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (1-methylcyclopropyl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
| SMILES | CC1(OC(=O)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H16F2O3/c1-17(10-11-17)23-16(21)18(22,12-2-6-14(19)7-3-12)13-4-8-15(20)9-5-13/h2-9,22H,10-11H2,1H3 |
| InChIKey | JROGWYSMIFAMOC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |