C16H19FO4 — CID 103974834
2-(cyclobutylmethyl)-3-ethoxy-2-(4-fluorophenyl)-3-oxopropanoic acid (PubChem CID 103974834) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-3-ethoxy-2-(4-fluorophenyl)-3-oxopropanoic acid.
| Compound Name | 2-(cyclobutylmethyl)-3-ethoxy-2-(4-fluorophenyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 103974834 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(cyclobutylmethyl)-3-ethoxy-2-(4-fluorophenyl)-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(CC1CCC1)(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FO4/c1-2-21-15(20)16(14(18)19,10-11-4-3-5-11)12-6-8-13(17)9-7-12/h6-9,11H,2-5,10H2,1H3,(H,18,19) |
| InChIKey | VKDMZIIKMLHHKI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|