C17H24FNO2 — CID 106490266
ethyl 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoate (PubChem CID 106490266) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoate.
| Compound Name | ethyl 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 106490266 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | ethyl 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoate |
| SMILES | CCOC(=O)C(CN)(CC1CCCC1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H24FNO2/c1-2-21-16(20)17(12-19,11-13-6-3-4-7-13)14-8-5-9-15(18)10-14/h5,8-10,13H,2-4,6-7,11-12,19H2,1H3 |
| InChIKey | URYPKSRBVOOZLL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |