C14H20FNO4S — CID 106490287
ethyl 2-(aminomethyl)-2-(3-fluorophenyl)-4-methylsulfonylbutanoate (PubChem CID 106490287) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-(3-fluorophenyl)-4-methylsulfonylbutanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-(3-fluorophenyl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 106490287 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-(3-fluorophenyl)-4-methylsulfonylbutanoate |
| SMILES | CCOC(=O)C(CN)(CCS(C)(=O)=O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO4S/c1-3-20-13(17)14(10-16,7-8-21(2,18)19)11-5-4-6-12(15)9-11/h4-6,9H,3,7-8,10,16H2,1-2H3 |
| InChIKey | HVNUETVYVSGZJD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |