C16H22FNO2 — CID 106490280
ethyl 2-(aminomethyl)-4-cyclopropyl-2-(3-fluorophenyl)butanoate (PubChem CID 106490280) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-4-cyclopropyl-2-(3-fluorophenyl)butanoate.
| Compound Name | ethyl 2-(aminomethyl)-4-cyclopropyl-2-(3-fluorophenyl)butanoate |
|---|---|
| PubChem CID | 106490280 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethyl 2-(aminomethyl)-4-cyclopropyl-2-(3-fluorophenyl)butanoate |
| SMILES | CCOC(=O)C(CN)(CCC1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO2/c1-2-20-15(19)16(11-18,9-8-12-6-7-12)13-4-3-5-14(17)10-13/h3-5,10,12H,2,6-9,11,18H2,1H3 |
| InChIKey | XOXVMSCSAQRWMP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |