C15H20FNO2 — CID 106490422
2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoic acid (PubChem CID 106490422) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 106490422 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(aminomethyl)-3-cyclopentyl-2-(3-fluorophenyl)propanoic acid |
| SMILES | NCC(CC1CCCC1)(C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO2/c16-13-7-3-6-12(8-13)15(10-17,14(18)19)9-11-4-1-2-5-11/h3,6-8,11H,1-2,4-5,9-10,17H2,(H,18,19) |
| InChIKey | WFDAOKXQWHIDMI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |