C13H16FNO2 — CID 106509500
methyl 3-amino-2-cyclopropyl-2-(3-fluorophenyl)propanoate (PubChem CID 106509500) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is methyl 3-amino-2-cyclopropyl-2-(3-fluorophenyl)propanoate.
| Compound Name | methyl 3-amino-2-cyclopropyl-2-(3-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 106509500 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | methyl 3-amino-2-cyclopropyl-2-(3-fluorophenyl)propanoate |
| SMILES | COC(=O)C(CN)(c1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C13H16FNO2/c1-17-12(16)13(8-15,9-5-6-9)10-3-2-4-11(14)7-10/h2-4,7,9H,5-6,8,15H2,1H3 |
| InChIKey | PLNNUBPKFOCIKP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |