C13H18FNO2 — CID 115043081
methyl 2-amino-3-(3-fluorophenyl)-2,3-dimethylbutanoate (PubChem CID 115043081) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is methyl 2-amino-3-(3-fluorophenyl)-2,3-dimethylbutanoate.
| Compound Name | methyl 2-amino-3-(3-fluorophenyl)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 115043081 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | methyl 2-amino-3-(3-fluorophenyl)-2,3-dimethylbutanoate |
| SMILES | COC(=O)C(C)(N)C(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H18FNO2/c1-12(2,13(3,15)11(16)17-4)9-6-5-7-10(14)8-9/h5-8H,15H2,1-4H3 |
| InChIKey | QDHCXLUUMQFRNI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |