C13H17NO2 — CID 106490812
3-amino-2-cyclopropyl-2-(3-methylphenyl)propanoic acid (PubChem CID 106490812) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-amino-2-cyclopropyl-2-(3-methylphenyl)propanoic acid.
| Compound Name | 3-amino-2-cyclopropyl-2-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 106490812 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-amino-2-cyclopropyl-2-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc(C(CN)(C(=O)O)C2CC2)c1 |
| InChI | InChI=1S/C13H17NO2/c1-9-3-2-4-11(7-9)13(8-14,12(15)16)10-5-6-10/h2-4,7,10H,5-6,8,14H2,1H3,(H,15,16) |
| InChIKey | XJWLQEDOYPIBGP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |