C15H20F3NO2 — CID 106509552
ethyl 2-(aminomethyl)-6,6,6-trifluoro-2-phenylhexanoate (PubChem CID 106509552) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-6,6,6-trifluoro-2-phenylhexanoate.
| Compound Name | ethyl 2-(aminomethyl)-6,6,6-trifluoro-2-phenylhexanoate |
|---|---|
| PubChem CID | 106509552 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | ethyl 2-(aminomethyl)-6,6,6-trifluoro-2-phenylhexanoate |
| SMILES | CCOC(=O)C(CN)(CCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H20F3NO2/c1-2-21-13(20)14(11-19,9-6-10-15(16,17)18)12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11,19H2,1H3 |
| InChIKey | ACSADTLPRVIJCA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |