C15H21FO3 — CID 10563763
ethyl (2S)-7-(18F)fluoro-2-hydroxy-2-phenylheptanoate (PubChem CID 10563763) has the molecular formula C15H21FO3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl (2S)-7-(18F)fluoro-2-hydroxy-2-phenylheptanoate.
| Compound Name | ethyl (2S)-7-(18F)fluoro-2-hydroxy-2-phenylheptanoate |
|---|---|
| PubChem CID | 10563763 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | ethyl (2S)-7-(18F)fluoro-2-hydroxy-2-phenylheptanoate |
| SMILES | CCOC(=O)[C@](O)(CCCCC[18F])c1ccccc1 |
| InChI | InChI=1S/C15H21FO3/c1-2-19-14(17)15(18,11-7-4-8-12-16)13-9-5-3-6-10-13/h3,5-6,9-10,18H,2,4,7-8,11-12H2,1H3/t15-/m0/s1/i16-1 |
| InChIKey | TXWXASOOMYIVIF-KJGMYMDNSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|