C14H19F2NO2 — CID 106487028
ethyl 2-(aminomethyl)-4,4-difluoro-2-methyl-4-phenylbutanoate (PubChem CID 106487028) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-4,4-difluoro-2-methyl-4-phenylbutanoate.
| Compound Name | ethyl 2-(aminomethyl)-4,4-difluoro-2-methyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 106487028 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | ethyl 2-(aminomethyl)-4,4-difluoro-2-methyl-4-phenylbutanoate |
| SMILES | CCOC(=O)C(C)(CN)CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C14H19F2NO2/c1-3-19-12(18)13(2,10-17)9-14(15,16)11-7-5-4-6-8-11/h4-8H,3,9-10,17H2,1-2H3 |
| InChIKey | MSOGZZAPAGVFAZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |