C16H23F2NO2 — CID 106490314
ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methylhexanoate (PubChem CID 106490314) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methylhexanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 106490314 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methylhexanoate |
| SMILES | CCOC(=O)C(CN)(CCC(C)C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H23F2NO2/c1-4-21-15(20)16(10-19,6-5-11(2)3)12-7-13(17)9-14(18)8-12/h7-9,11H,4-6,10,19H2,1-3H3 |
| InChIKey | CTWGKLGYMAJFQQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |