C15H21F2NO3 — CID 106490323
ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methoxypentanoate (PubChem CID 106490323) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methoxypentanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methoxypentanoate |
|---|---|
| PubChem CID | 106490323 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-(3,5-difluorophenyl)-5-methoxypentanoate |
| SMILES | CCOC(=O)C(CN)(CCCOC)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H21F2NO3/c1-3-21-14(19)15(10-18,5-4-6-20-2)11-7-12(16)9-13(17)8-11/h7-9H,3-6,10,18H2,1-2H3 |
| InChIKey | GHGQVJLXRYQWEO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|