C15H23NO3 — CID 106509400
methyl 2-(aminomethyl)-5-methoxy-2-(3-methylphenyl)pentanoate (PubChem CID 106509400) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-5-methoxy-2-(3-methylphenyl)pentanoate.
| Compound Name | methyl 2-(aminomethyl)-5-methoxy-2-(3-methylphenyl)pentanoate |
|---|---|
| PubChem CID | 106509400 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 2-(aminomethyl)-5-methoxy-2-(3-methylphenyl)pentanoate |
| SMILES | COCCCC(CN)(C(=O)OC)c1cccc(C)c1 |
| InChI | InChI=1S/C15H23NO3/c1-12-6-4-7-13(10-12)15(11-16,14(17)19-3)8-5-9-18-2/h4,6-7,10H,5,8-9,11,16H2,1-3H3 |
| InChIKey | BOFOMWTVXBWCMC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|