C14H17FO6 — CID 103974815
2-ethoxycarbonyl-2-(4-fluorophenyl)-4,5-dihydroxypentanoic acid (PubChem CID 103974815) has the molecular formula C14H17FO6 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-(4-fluorophenyl)-4,5-dihydroxypentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-(4-fluorophenyl)-4,5-dihydroxypentanoic acid |
|---|---|
| PubChem CID | 103974815 |
| Molecular Formula | C14H17FO6 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-ethoxycarbonyl-2-(4-fluorophenyl)-4,5-dihydroxypentanoic acid |
| SMILES | CCOC(=O)C(CC(O)CO)(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FO6/c1-2-21-13(20)14(12(18)19,7-11(17)8-16)9-3-5-10(15)6-4-9/h3-6,11,16-17H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | UGYZUOBTPOFVDJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|