C15H20O6 — CID 103974849
2-ethoxycarbonyl-4,5-dihydroxy-2-(3-methylphenyl)pentanoic acid (PubChem CID 103974849) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4,5-dihydroxy-2-(3-methylphenyl)pentanoic acid.
| Compound Name | 2-ethoxycarbonyl-4,5-dihydroxy-2-(3-methylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 103974849 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-ethoxycarbonyl-4,5-dihydroxy-2-(3-methylphenyl)pentanoic acid |
| SMILES | CCOC(=O)C(CC(O)CO)(C(=O)O)c1cccc(C)c1 |
| InChI | InChI=1S/C15H20O6/c1-3-21-14(20)15(13(18)19,8-12(17)9-16)11-6-4-5-10(2)7-11/h4-7,12,16-17H,3,8-9H2,1-2H3,(H,18,19) |
| InChIKey | TUTHXRSTIJBGMD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|