C13H15BrO5 — CID 113361923
2-(3-bromophenyl)-3-ethoxy-2-(methoxymethyl)-3-oxopropanoic acid (PubChem CID 113361923) has the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-ethoxy-2-(methoxymethyl)-3-oxopropanoic acid.
| Compound Name | 2-(3-bromophenyl)-3-ethoxy-2-(methoxymethyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 113361923 |
| Molecular Formula | C13H15BrO5 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-(3-bromophenyl)-3-ethoxy-2-(methoxymethyl)-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(COC)(C(=O)O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrO5/c1-3-19-12(17)13(8-18-2,11(15)16)9-5-4-6-10(14)7-9/h4-7H,3,8H2,1-2H3,(H,15,16) |
| InChIKey | WGGFTWIJRQDVLH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|