C15H16BrClO4 — CID 106440924
(E)-2-(3-bromophenyl)-5-chloro-2-ethoxycarbonyl-4-methylpent-4-enoic acid (PubChem CID 106440924) has the molecular formula C15H16BrClO4 and a molecular weight of 375.65 g/mol. Its IUPAC name is (E)-2-(3-bromophenyl)-5-chloro-2-ethoxycarbonyl-4-methylpent-4-enoic acid.
| Compound Name | (E)-2-(3-bromophenyl)-5-chloro-2-ethoxycarbonyl-4-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 106440924 |
| Molecular Formula | C15H16BrClO4 |
| Molecular Weight | 375.65 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | (E)-2-(3-bromophenyl)-5-chloro-2-ethoxycarbonyl-4-methylpent-4-enoic acid |
| SMILES | CCOC(=O)C(C/C(C)=C/Cl)(C(=O)O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16BrClO4/c1-3-21-14(20)15(13(18)19,8-10(2)9-17)11-5-4-6-12(16)7-11/h4-7,9H,3,8H2,1-2H3,(H,18,19)/b10-9+ |
| InChIKey | JWRXFCOKQZUCSL-MDZDMXLPSA-N |
| XLogP | 3.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|