C13H12ClF3O4 — CID 103974959
2-(3-chlorophenyl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid (PubChem CID 103974959) has the molecular formula C13H12ClF3O4 and a molecular weight of 324.68 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-(3-chlorophenyl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 103974959 |
| Molecular Formula | C13H12ClF3O4 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-(3-chlorophenyl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid |
| SMILES | CCOC(=O)C(CC(F)(F)F)(C(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClF3O4/c1-2-21-11(20)12(10(18)19,7-13(15,16)17)8-4-3-5-9(14)6-8/h3-6H,2,7H2,1H3,(H,18,19) |
| InChIKey | NSXFLAJPTYVWNK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|