C16H20N2O3 — CID 102134131
2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl carbonate (PubChem CID 102134131) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl carbonate.
| Compound Name | 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl carbonate |
|---|---|
| PubChem CID | 102134131 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl carbonate |
| SMILES | CC(C)c1n(CCOC(=O)[O-])cc[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-13(2)15-17(10-11-21-16(19)20)8-9-18(15)12-14-6-4-3-5-7-14/h3-9,13H,10-12H2,1-2H3 |
| InChIKey | BOTLKNCVPJYPRZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|