C25H26N3OS2+ — CID 46931873
4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-dithiophen-2-ylbutanamide (PubChem CID 46931873) has the molecular formula C25H26N3OS2+ and a molecular weight of 448.64 g/mol. Its IUPAC name is 4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-dithiophen-2-ylbutanamide.
| Compound Name | 4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-dithiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 46931873 |
| Molecular Formula | C25H26N3OS2+ |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-dithiophen-2-ylbutanamide |
| SMILES | Cc1n(CCC(C(N)=O)(c2cccs2)c2cccs2)cc[n+]1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H25N3OS2/c1-20-27(14-5-10-21-8-3-2-4-9-21)16-17-28(20)15-13-25(24(26)29,22-11-6-18-30-22)23-12-7-19-31-23/h2-12,16-19H,13-15H2,1H3,(H-,26,29)/p+1/b10-5+ |
| InChIKey | REKKUXQQKAYDRO-BJMVGYQFSA-O |
| XLogP | 4.78 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|