C15H15NO — CID 79107239
1-[1-(3-phenylprop-2-enyl)pyrrol-2-yl]ethanone (PubChem CID 79107239) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-[1-(3-phenylprop-2-enyl)pyrrol-2-yl]ethanone.
| Compound Name | 1-[1-(3-phenylprop-2-enyl)pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 79107239 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-[1-(3-phenylprop-2-enyl)pyrrol-2-yl]ethanone |
| SMILES | CC(=O)c1cccn1CC=Cc1ccccc1 |
| InChI | InChI=1S/C15H15NO/c1-13(17)15-10-6-12-16(15)11-5-9-14-7-3-2-4-8-14/h2-10,12H,11H2,1H3 |
| InChIKey | FEZYIMFTJNQKOD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |