C21H18ClNO2 — CID 89258991
[1-[(E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone (PubChem CID 89258991) has the molecular formula C21H18ClNO2 and a molecular weight of 351.83 g/mol. Its IUPAC name is [1-[(E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [1-[(E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 89258991 |
| Molecular Formula | C21H18ClNO2 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [1-[(E)-3-(4-chloro-3-hydroxyphenyl)prop-2-enyl]pyrrol-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cccn2C/C=C/c2ccc(Cl)c(O)c2)cc1 |
| InChI | InChI=1S/C21H18ClNO2/c1-15-6-9-17(10-7-15)21(25)19-5-3-13-23(19)12-2-4-16-8-11-18(22)20(24)14-16/h2-11,13-14,24H,12H2,1H3/b4-2+ |
| InChIKey | CKMADPDMOACBKF-DUXPYHPUSA-N |
| XLogP | 5.10 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |